C9H11NO2 — CID 11480633
(E)-3-(furan-2-yl)-N,N-dimethylprop-2-enamide (PubChem CID 11480633) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 11480633 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (E)-3-(furan-2-yl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C9H11NO2/c1-10(2)9(11)6-5-8-4-3-7-12-8/h3-7H,1-2H3/b6-5+ |
| InChIKey | QKBTWUHOINANFF-AATRIKPKSA-N |
| XLogP | 1.38 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|