C10H10O3 — CID 774945
(2Z,4E)-5-(furan-2-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 774945) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (2Z,4E)-5-(furan-2-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(furan-2-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 774945 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (2Z,4E)-5-(furan-2-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/c1ccco1 |
| InChI | InChI=1S/C10H10O3/c1-8(7-10(11)12)4-5-9-3-2-6-13-9/h2-7H,1H3,(H,11,12)/b5-4+,8-7- |
| InChIKey | YQUYSXFOPNDMKO-HTKRNXBHSA-N |
| XLogP | 2.32 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|