C11H10O2 — CID 102297621
(1E)-1-(furan-2-yl)-4-methylhexa-1,4,5-trien-3-one (PubChem CID 102297621) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1E)-1-(furan-2-yl)-4-methylhexa-1,4,5-trien-3-one.
| Compound Name | (1E)-1-(furan-2-yl)-4-methylhexa-1,4,5-trien-3-one |
|---|---|
| PubChem CID | 102297621 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (1E)-1-(furan-2-yl)-4-methylhexa-1,4,5-trien-3-one |
| SMILES | C=C=C(C)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C11H10O2/c1-3-9(2)11(12)7-6-10-5-4-8-13-10/h4-8H,1H2,2H3/b7-6+ |
| InChIKey | BOGMOLUQYBOMCC-VOTSOKGWSA-N |
| XLogP | 2.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|