C16H14O4 — CID 121298354
(E,4Z)-7-(furan-2-yl)-4-(furan-2-ylmethylidene)hept-6-ene-2,5-dione (PubChem CID 121298354) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (E,4Z)-7-(furan-2-yl)-4-(furan-2-ylmethylidene)hept-6-ene-2,5-dione.
| Compound Name | (E,4Z)-7-(furan-2-yl)-4-(furan-2-ylmethylidene)hept-6-ene-2,5-dione |
|---|---|
| PubChem CID | 121298354 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (E,4Z)-7-(furan-2-yl)-4-(furan-2-ylmethylidene)hept-6-ene-2,5-dione |
| SMILES | CC(=O)C/C(=C/c1ccco1)C(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C16H14O4/c1-12(17)10-13(11-15-5-3-9-20-15)16(18)7-6-14-4-2-8-19-14/h2-9,11H,10H2,1H3/b7-6+,13-11- |
| InChIKey | LADBFQAISJEXNH-UJSHDLROSA-N |
| XLogP | 3.52 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|