C15H12O5 — CID 149365337
(Z,3Z)-6-(furan-2-yl)-3-(furan-2-ylmethylidene)-4-oxohex-5-enoic acid (PubChem CID 149365337) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is (Z,3Z)-6-(furan-2-yl)-3-(furan-2-ylmethylidene)-4-oxohex-5-enoic acid.
| Compound Name | (Z,3Z)-6-(furan-2-yl)-3-(furan-2-ylmethylidene)-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 149365337 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (Z,3Z)-6-(furan-2-yl)-3-(furan-2-ylmethylidene)-4-oxohex-5-enoic acid |
| SMILES | O=C(O)C/C(=C/c1ccco1)C(=O)/C=C\c1ccco1 |
| InChI | InChI=1S/C15H12O5/c16-14(6-5-12-3-1-7-19-12)11(10-15(17)18)9-13-4-2-8-20-13/h1-9H,10H2,(H,17,18)/b6-5-,11-9- |
| InChIKey | YISSIOHJGQLAPK-AZFXQDNWSA-N |
| XLogP | 3.01 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|