C12H12O2 — CID 774941
(4E)-3-methyl-5-phenylpenta-2,4-dienoic acid (PubChem CID 774941) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (4E)-3-methyl-5-phenylpenta-2,4-dienoic acid.
| Compound Name | (4E)-3-methyl-5-phenylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 774941 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (4E)-3-methyl-5-phenylpenta-2,4-dienoic acid |
| SMILES | CC(=CC(=O)O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-10(9-12(13)14)7-8-11-5-3-2-4-6-11/h2-9H,1H3,(H,13,14)/b8-7+,10-9? |
| InChIKey | QBUCMPDJJMSFCR-JSGCFVPUSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|