C12H11NO4 — CID 3730066
3-methyl-5-(4-nitrophenyl)penta-2,4-dienoic acid (PubChem CID 3730066) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-methyl-5-(4-nitrophenyl)penta-2,4-dienoic acid.
| Compound Name | 3-methyl-5-(4-nitrophenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 3730066 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-methyl-5-(4-nitrophenyl)penta-2,4-dienoic acid |
| SMILES | CC(C=Cc1ccc([N+](=O)[O-])cc1)=CC(=O)O |
| InChI | InChI=1S/C12H11NO4/c1-9(8-12(14)15)2-3-10-4-6-11(7-5-10)13(16)17/h2-8H,1H3,(H,14,15) |
| InChIKey | JGOBGAMTXYHXIO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|