C12H11NO4S — CID 135542417
S-methyl (2Z,4E)-3-hydroxy-5-(4-nitrophenyl)penta-2,4-dienethioate (PubChem CID 135542417) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is S-methyl (2Z,4E)-3-hydroxy-5-(4-nitrophenyl)penta-2,4-dienethioate.
| Compound Name | S-methyl (2Z,4E)-3-hydroxy-5-(4-nitrophenyl)penta-2,4-dienethioate |
|---|---|
| PubChem CID | 135542417 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | S-methyl (2Z,4E)-3-hydroxy-5-(4-nitrophenyl)penta-2,4-dienethioate |
| SMILES | CSC(=O)/C=C(O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H11NO4S/c1-18-12(15)8-11(14)7-4-9-2-5-10(6-3-9)13(16)17/h2-8,14H,1H3/b7-4+,11-8- |
| InChIKey | YEHBBUVCYHFLSA-KXBBGWRGSA-N |
| XLogP | 2.94 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|