C18H15NO4S — CID 71835130
1-hydroxy-5-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)penta-1,4-dien-3-one (PubChem CID 71835130) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-hydroxy-5-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)penta-1,4-dien-3-one.
| Compound Name | 1-hydroxy-5-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 71835130 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-hydroxy-5-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)penta-1,4-dien-3-one |
| SMILES | CSc1ccc(C=CC(=O)C=C(O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H15NO4S/c1-24-17-10-3-13(4-11-17)2-9-16(20)12-18(21)14-5-7-15(8-6-14)19(22)23/h2-12,21H,1H3 |
| InChIKey | UCJHEFCYWYSGRO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|