C20H17NO6 — CID 175836037
5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-(4-nitrophenyl)hepta-1,4,6-trien-3-one (PubChem CID 175836037) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-(4-nitrophenyl)hepta-1,4,6-trien-3-one.
| Compound Name | 5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-(4-nitrophenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 175836037 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-1-(4-nitrophenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1cc(C=CC(O)=CC(=O)C=Cc2ccc([N+](=O)[O-])cc2)ccc1O |
| InChI | InChI=1S/C20H17NO6/c1-27-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(8-3-14)21(25)26/h2-13,23-24H,1H3 |
| InChIKey | HIOKIQHDYXHJGU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|