C27H31BO8 — CID 101465714
(1E,4Z,6E)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hepta-1,4,6-trien-3-one (PubChem CID 101465714) has the molecular formula C27H31BO8 and a molecular weight of 494.35 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 101465714 |
| Molecular Formula | C27H31BO8 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hepta-1,4,6-trien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C(O)/C=C/c2cc(OC)c(O)c(B3OC(C)(C)C(C)(C)O3)c2)ccc1O |
| InChI | InChI=1S/C27H31BO8/c1-26(2)27(3,4)36-28(35-26)21-13-18(15-24(34-6)25(21)32)8-11-20(30)16-19(29)10-7-17-9-12-22(31)23(14-17)33-5/h7-16,30-32H,1-6H3/b10-7+,11-8+,20-16- |
| InChIKey | MGUWJAWXLJCJNR-DDUUWMIMSA-N |
| XLogP | 4.15 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|