C21H19IO6 — CID 165367501
(4Z)-5-hydroxy-7-(4-hydroxy-3-(125I)iodo-5-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 165367501) has the molecular formula C21H19IO6 and a molecular weight of 492.28 g/mol. Its IUPAC name is (4Z)-5-hydroxy-7-(4-hydroxy-3-(125I)iodo-5-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (4Z)-5-hydroxy-7-(4-hydroxy-3-(125I)iodo-5-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 165367501 |
| Molecular Formula | C21H19IO6 |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | (4Z)-5-hydroxy-7-(4-hydroxy-3-(125I)iodo-5-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1cc(C=CC(=O)/C=C(\O)C=Cc2cc([125I])c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H19IO6/c1-27-19-10-13(5-8-18(19)25)3-6-15(23)12-16(24)7-4-14-9-17(22)21(26)20(11-14)28-2/h3-12,24-26H,1-2H3/b6-3?,7-4?,16-12-/i22-2 |
| InChIKey | GFSBJIUFDAUDNN-XQNMEXBRSA-N |
| XLogP | 4.46 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|