C18H16O5 — CID 71770064
(1Z,4E)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)penta-1,4-dien-3-one (PubChem CID 71770064) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is (1Z,4E)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1Z,4E)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 71770064 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (1Z,4E)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-1-(4-hydroxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C(\O)c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C18H16O5/c1-23-18-10-12(3-9-16(18)21)2-6-15(20)11-17(22)13-4-7-14(19)8-5-13/h2-11,19,21-22H,1H3/b6-2+,17-11- |
| InChIKey | MZPQCFMRSZLEBU-FMUNNUOPSA-N |
| XLogP | 3.29 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|