C11H10O5 — CID 690378
(Z,4Z)-4-(furan-2-ylmethylidene)-3-methylpent-2-enedioic acid (PubChem CID 690378) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is (Z,4Z)-4-(furan-2-ylmethylidene)-3-methylpent-2-enedioic acid.
| Compound Name | (Z,4Z)-4-(furan-2-ylmethylidene)-3-methylpent-2-enedioic acid |
|---|---|
| PubChem CID | 690378 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (Z,4Z)-4-(furan-2-ylmethylidene)-3-methylpent-2-enedioic acid |
| SMILES | CC(=C/C(=O)O)/C(=C/c1ccco1)C(=O)O |
| InChI | InChI=1S/C11H10O5/c1-7(5-10(12)13)9(11(14)15)6-8-3-2-4-16-8/h2-6H,1H3,(H,12,13)(H,14,15)/b7-5-,9-6- |
| InChIKey | GMACEYJBIPRXGU-BSIYMUDXSA-N |
| XLogP | 1.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|