C12H11NO4 — CID 2249506
(E,4Z)-3-methyl-4-(pyridin-4-ylmethylidene)pent-2-enedioic acid (PubChem CID 2249506) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is (E,4Z)-3-methyl-4-(pyridin-4-ylmethylidene)pent-2-enedioic acid.
| Compound Name | (E,4Z)-3-methyl-4-(pyridin-4-ylmethylidene)pent-2-enedioic acid |
|---|---|
| PubChem CID | 2249506 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (E,4Z)-3-methyl-4-(pyridin-4-ylmethylidene)pent-2-enedioic acid |
| SMILES | CC(=C\C(=O)O)/C(=C/c1ccncc1)C(=O)O |
| InChI | InChI=1S/C12H11NO4/c1-8(6-11(14)15)10(12(16)17)7-9-2-4-13-5-3-9/h2-7H,1H3,(H,14,15)(H,16,17)/b8-6+,10-7- |
| InChIKey | VMOTXUYWTLORON-ZPNWEIAESA-N |
| XLogP | 1.58 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|