C16H15ClF3N3O — CID 31846661
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 31846661) has the molecular formula C16H15ClF3N3O and a molecular weight of 357.76 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 31846661 |
| Molecular Formula | C16H15ClF3N3O |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | CN(Cc1cnn(C)c1)C(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15ClF3N3O/c1-22(9-12-8-21-23(2)10-12)15(24)6-4-11-3-5-14(17)13(7-11)16(18,19)20/h3-8,10H,9H2,1-2H3/b6-4+ |
| InChIKey | LFABPSGOUOLGMP-GQCTYLIASA-N |
| XLogP | 3.76 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|