C17H24N2O3 — CID 82325965
3-[3-(dimethylamino)propyl-[(E)-3-phenylprop-2-enoyl]amino]propanoic acid (PubChem CID 82325965) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl-[(E)-3-phenylprop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[3-(dimethylamino)propyl-[(E)-3-phenylprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82325965 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-[3-(dimethylamino)propyl-[(E)-3-phenylprop-2-enoyl]amino]propanoic acid |
| SMILES | CN(C)CCCN(CCC(=O)O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c1-18(2)12-6-13-19(14-11-17(21)22)16(20)10-9-15-7-4-3-5-8-15/h3-5,7-10H,6,11-14H2,1-2H3,(H,21,22)/b10-9+ |
| InChIKey | QLTTYWGSZXQXGD-MDZDMXLPSA-N |
| XLogP | 1.95 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|