About 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate
4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate (PubChem CID 21249779) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 21249779 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate |
| SMILES | CN(C)CCCCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-16(2)12-6-7-13-18-15(17)11-10-14-8-4-3-5-9-14/h3-5,8-11H,6-7,12-13H2,1-2H3/b11-10+ |
| InChIKey | MXSGIOHIFSXRCP-ZHACJKMWSA-N |
| XLogP | 2.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate (CID 21249779) is 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate is CN(C)CCCCOC(=O)/C=C/c1ccccc1.
What is the InChIKey of 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate?
The InChIKey is MXSGIOHIFSXRCP-ZHACJKMWSA-N. The full InChI is InChI=1S/C15H21NO2/c1-16(2)12-6-7-13-18-15(17)11-10-14-8-4-3-5-9-14/h3-5,8-11H,6-7,12-13H2,1-2H3/b11-10+.
What are the key properties of 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate?
4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate has a molecular weight of 247.34 g/mol, XLogP of 2.58, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)butyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 21249779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).