About 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate
3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate (PubChem CID 134925812) has the molecular formula C24H26Cl2O4Se
and a molecular weight of 528.33 g/mol. Its IUPAC name is 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 134925812 |
| Molecular Formula | C24H26Cl2O4Se |
| Molecular Weight | 528.33 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCCC[Se](Cl)(Cl)CCCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H26Cl2O4Se/c25-31(26,19-7-17-29-23(27)15-13-21-9-3-1-4-10-21)20-8-18-30-24(28)16-14-22-11-5-2-6-12-22/h1-6,9-16H,7-8,17-20H2/b15-13+,16-14+ |
| InChIKey | MFZMOBWHHYIHEK-WXUKJITCSA-N |
| XLogP | 6.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.33 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate (CID 134925812) is 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate is O=C(/C=C/c1ccccc1)OCCC[Se](Cl)(Cl)CCCOC(=O)/C=C/c1ccccc1.
What is the InChIKey of 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate?
The InChIKey is MFZMOBWHHYIHEK-WXUKJITCSA-N. The full InChI is InChI=1S/C24H26Cl2O4Se/c25-31(26,19-7-17-29-23(27)15-13-21-9-3-1-4-10-21)20-8-18-30-24(28)16-14-22-11-5-2-6-12-22/h1-6,9-16H,7-8,17-20H2/b15-13+,16-14+.
What are the key properties of 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate?
3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate has a molecular weight of 528.33 g/mol, XLogP of 6.20, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dichloro-[3-[(E)-3-phenylprop-2-enoyl]oxypropyl]-λ4-selanyl]propyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 134925812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).