About 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride
6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride (PubChem CID 19066595) has the molecular formula C15H22ClNO2
and a molecular weight of 283.80 g/mol. Its IUPAC name is 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride |
| PubChem CID | 19066595 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride |
| SMILES | Cl.NCCCCCCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H21NO2.ClH/c16-12-6-1-2-7-13-18-15(17)11-10-14-8-4-3-5-9-14;/h3-5,8-11H,1-2,6-7,12-13,16H2;1H/b11-10+; |
| InChIKey | FYXJZRRPHOIJAA-ASTDGNLGSA-N |
| XLogP | 3.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride?
The IUPAC name of 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride (CID 19066595) is 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride.
What is the SMILES notation for 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride?
The canonical SMILES for 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride is Cl.NCCCCCCOC(=O)/C=C/c1ccccc1.
What is the InChIKey of 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride?
The InChIKey is FYXJZRRPHOIJAA-ASTDGNLGSA-N. The full InChI is InChI=1S/C15H21NO2.ClH/c16-12-6-1-2-7-13-18-15(17)11-10-14-8-4-3-5-9-14;/h3-5,8-11H,1-2,6-7,12-13,16H2;1H/b11-10+;.
What are the key properties of 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride?
6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride has a molecular weight of 283.80 g/mol, XLogP of 3.18, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminohexyl (E)-3-phenylprop-2-enoate;hydrochloride is sourced from PubChem (CID 19066595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).