C25H34O6 — CID 121346814
4-[8-(3-phenylprop-2-enoyloxy)octoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 121346814) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 4-[8-(3-phenylprop-2-enoyloxy)octoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[8-(3-phenylprop-2-enoyloxy)octoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121346814 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 4-[8-(3-phenylprop-2-enoyloxy)octoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccccc1)OCCCCCCCCOC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C25H34O6/c26-23(17-12-20-10-6-5-7-11-20)30-18-8-3-1-2-4-9-19-31-25(29)22-15-13-21(14-16-22)24(27)28/h5-7,10-12,17,21-22H,1-4,8-9,13-16,18-19H2,(H,27,28) |
| InChIKey | NNLWPJYJBZSTLN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|