C16H21N3O3S — CID 51983675
(E)-N-[(2R)-2-cyanopropyl]-N-ethyl-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 51983675) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is (E)-N-[(2R)-2-cyanopropyl]-N-ethyl-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-cyanopropyl]-N-ethyl-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 51983675 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (E)-N-[(2R)-2-cyanopropyl]-N-ethyl-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CCN(C[C@@H](C)C#N)C(=O)/C=C/c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H21N3O3S/c1-4-19(12-13(2)11-17)16(20)10-7-14-5-8-15(9-6-14)18-23(3,21)22/h5-10,13,18H,4,12H2,1-3H3/b10-7+/t13-/m0/s1 |
| InChIKey | CTQKYRQDHDHZDI-RSPDNQDQSA-N |
| XLogP | 2.08 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|