C21H24Cl2N2O3S — CID 98917558
(E)-N-[(3,4-dichlorophenyl)methyl]-3-[4-(ethylsulfamoyl)phenyl]-N-propan-2-ylprop-2-enamide (PubChem CID 98917558) has the molecular formula C21H24Cl2N2O3S and a molecular weight of 455.41 g/mol. Its IUPAC name is (E)-N-[(3,4-dichlorophenyl)methyl]-3-[4-(ethylsulfamoyl)phenyl]-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-N-[(3,4-dichlorophenyl)methyl]-3-[4-(ethylsulfamoyl)phenyl]-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 98917558 |
| Molecular Formula | C21H24Cl2N2O3S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (E)-N-[(3,4-dichlorophenyl)methyl]-3-[4-(ethylsulfamoyl)phenyl]-N-propan-2-ylprop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)N(Cc2ccc(Cl)c(Cl)c2)C(C)C)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O3S/c1-4-24-29(27,28)18-9-5-16(6-10-18)8-12-21(26)25(15(2)3)14-17-7-11-19(22)20(23)13-17/h5-13,15,24H,4,14H2,1-3H3/b12-8+ |
| InChIKey | CGUKZLQNENJWEI-XYOKQWHBSA-N |
| XLogP | 4.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|