C19H19Cl2FN2O3S — CID 55678594
(E)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55678594) has the molecular formula C19H19Cl2FN2O3S and a molecular weight of 445.34 g/mol. Its IUPAC name is (E)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55678594 |
| Molecular Formula | C19H19Cl2FN2O3S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (E)-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[4-(ethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)NC(C)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2FN2O3S/c1-3-23-28(26,27)14-7-4-13(5-8-14)6-9-19(25)24-12(2)15-10-18(22)17(21)11-16(15)20/h4-12,23H,3H2,1-2H3,(H,24,25)/b9-6+ |
| InChIKey | IEUVQGDIHIKULW-RMKNXTFCSA-N |
| XLogP | 4.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|