C16H14Cl2N2O3S — CID 1313185
(E)-3-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide (PubChem CID 1313185) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 1313185 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c17-14-7-3-11(9-15(14)18)4-8-16(21)20-10-12-1-5-13(6-2-12)24(19,22)23/h1-9H,10H2,(H,20,21)(H2,19,22,23)/b8-4+ |
| InChIKey | URJFRYCOLQKSTB-XBXARRHUSA-N |
| XLogP | 2.97 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|