C16H15BrN2O3S — CID 51333544
(E)-N-(4-bromophenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 51333544) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is (E)-N-(4-bromophenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-bromophenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 51333544 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | (E)-N-(4-bromophenyl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H15BrN2O3S/c1-23(21,22)19-15-7-2-12(3-8-15)4-11-16(20)18-14-9-5-13(17)6-10-14/h2-11,19H,1H3,(H,18,20)/b11-4+ |
| InChIKey | STVVWMBOEBXBPP-NYYWCZLTSA-N |
| XLogP | 3.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|