C17H16N2O5S — CID 31223315
(E)-N-(1,3-benzodioxol-5-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 31223315) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 31223315 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-25(21,22)19-13-5-2-12(3-6-13)4-9-17(20)18-14-7-8-15-16(10-14)24-11-23-15/h2-10,19H,11H2,1H3,(H,18,20)/b9-4+ |
| InChIKey | STTNWVZMQFKYKZ-RUDMXATFSA-N |
| XLogP | 2.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|