C17H14FNO4 — CID 9042657
(E)-N-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide (PubChem CID 9042657) has the molecular formula C17H14FNO4 and a molecular weight of 315.30 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9042657 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C17H14FNO4/c1-21-14-5-2-11(8-13(14)18)3-7-17(20)19-12-4-6-15-16(9-12)23-10-22-15/h2-9H,10H2,1H3,(H,19,20)/b7-3+ |
| InChIKey | YEKYGSLKEWOUSO-XVNBXDOJSA-N |
| XLogP | 3.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|