C16H19NO3 — CID 78978456
ethyl 2-[[(E)-3-phenylprop-2-enoyl]-prop-2-enylamino]acetate (PubChem CID 78978456) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-phenylprop-2-enoyl]-prop-2-enylamino]acetate.
| Compound Name | ethyl 2-[[(E)-3-phenylprop-2-enoyl]-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 78978456 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl 2-[[(E)-3-phenylprop-2-enoyl]-prop-2-enylamino]acetate |
| SMILES | C=CCN(CC(=O)OCC)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-3-12-17(13-16(19)20-4-2)15(18)11-10-14-8-6-5-7-9-14/h3,5-11H,1,4,12-13H2,2H3/b11-10+ |
| InChIKey | VRFQPCGSCRLXDY-ZHACJKMWSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|