C11H10F2O2 — CID 116991834
(E)-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enoic acid (PubChem CID 116991834) has the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. Its IUPAC name is (E)-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116991834 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (E)-3-[4-(1,1-difluoroethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(F)(F)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C11H10F2O2/c1-11(12,13)9-5-2-8(3-6-9)4-7-10(14)15/h2-7H,1H3,(H,14,15)/b7-4+ |
| InChIKey | WJFPCHQCRVQSPT-QPJJXVBHSA-N |
| XLogP | 2.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|