C13H14F2O2 — CID 116992184
(E)-3-[4-(1,1-difluorobutyl)phenyl]prop-2-enoic acid (PubChem CID 116992184) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is (E)-3-[4-(1,1-difluorobutyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(1,1-difluorobutyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116992184 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (E)-3-[4-(1,1-difluorobutyl)phenyl]prop-2-enoic acid |
| SMILES | CCCC(F)(F)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H14F2O2/c1-2-9-13(14,15)11-6-3-10(4-7-11)5-8-12(16)17/h3-8H,2,9H2,1H3,(H,16,17)/b8-5+ |
| InChIKey | LLEDHMRNUXWXCP-VMPITWQZSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|