C18H24N2O2 — CID 108516808
N-(4-tert-butylphenyl)-N',N'-bis(prop-2-enyl)oxamide (PubChem CID 108516808) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N',N'-bis(prop-2-enyl)oxamide.
| Compound Name | N-(4-tert-butylphenyl)-N',N'-bis(prop-2-enyl)oxamide |
|---|---|
| PubChem CID | 108516808 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-N',N'-bis(prop-2-enyl)oxamide |
| SMILES | C=CCN(CC=C)C(=O)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-6-12-20(13-7-2)17(22)16(21)19-15-10-8-14(9-11-15)18(3,4)5/h6-11H,1-2,12-13H2,3-5H3,(H,19,21) |
| InChIKey | JSDFFKUJSROFSD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|