C23H35NO4 — CID 18962917
2-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid (PubChem CID 18962917) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18962917 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 2-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]acetic acid |
| SMILES | CCCCN(CC(=O)O)C(=O)/C=C/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H35NO4/c1-8-9-12-24(15-20(26)27)19(25)11-10-16-13-17(22(2,3)4)21(28)18(14-16)23(5,6)7/h10-11,13-14,28H,8-9,12,15H2,1-7H3,(H,26,27)/b11-10+ |
| InChIKey | HYQGYFDVMOYTNB-ZHACJKMWSA-N |
| XLogP | 4.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|