C28H37NO4 — CID 54216975
4-[butyl-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 54216975) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is 4-[butyl-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[butyl-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 54216975 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 4-[butyl-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | CCCCN(C(=O)C=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H37NO4/c1-8-9-16-29(21-13-11-20(12-14-21)26(32)33)24(30)15-10-19-17-22(27(2,3)4)25(31)23(18-19)28(5,6)7/h10-15,17-18,31H,8-9,16H2,1-7H3,(H,32,33) |
| InChIKey | PZWHWMKGAUEMKM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|