C31H39N3O3S — CID 24834283
4-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 24834283) has the molecular formula C31H39N3O3S and a molecular weight of 533.74 g/mol. Its IUPAC name is 4-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 24834283 |
| Molecular Formula | C31H39N3O3S |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 4-[butyl-[(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoyl]amino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCCCN(C(=O)/C=C/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccc(C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C31H39N3O3S/c1-8-9-17-34(23-13-11-22(12-14-23)28(37)33-29-32-16-18-38-29)26(35)15-10-21-19-24(30(2,3)4)27(36)25(20-21)31(5,6)7/h10-16,18-20,36H,8-9,17H2,1-7H3,(H,32,33,37)/b15-10+ |
| InChIKey | IGGYKCYJTGRGPQ-XNTDXEJSSA-N |
| XLogP | 7.54 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|