C14H13N3O2S — CID 134062092
N-methyl-4-[(E)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-enyl]benzamide (PubChem CID 134062092) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[(E)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 134062092 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-methyl-4-[(E)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C14H13N3O2S/c1-15-13(19)11-5-2-10(3-6-11)4-7-12(18)17-14-16-8-9-20-14/h2-9H,1H3,(H,15,19)(H,16,17,18)/b7-4+ |
| InChIKey | AXBIVVIEKZIWQS-QPJJXVBHSA-N |
| XLogP | 2.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|