C17H16BrN3O2 — CID 91944206
4-[3-[(6-bromo-5-methyl-3-pyridinyl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 91944206) has the molecular formula C17H16BrN3O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is 4-[3-[(6-bromo-5-methyl-3-pyridinyl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[3-[(6-bromo-5-methyl-3-pyridinyl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 91944206 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4-[3-[(6-bromo-5-methyl-3-pyridinyl)amino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(C=CC(=O)Nc2cnc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C17H16BrN3O2/c1-11-9-14(10-20-16(11)18)21-15(22)8-5-12-3-6-13(7-4-12)17(23)19-2/h3-10H,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | VIGVVNQSTUTKMI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|