C19H19BrN2O2 — CID 110300748
4-[(E)-3-(3-bromo-4-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide (PubChem CID 110300748) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 4-[(E)-3-(3-bromo-4-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-3-(3-bromo-4-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 110300748 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-[(E)-3-(3-bromo-4-methylanilino)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2ccc(C(=O)N(C)C)cc2)cc1Br |
| InChI | InChI=1S/C19H19BrN2O2/c1-13-4-10-16(12-17(13)20)21-18(23)11-7-14-5-8-15(9-6-14)19(24)22(2)3/h4-12H,1-3H3,(H,21,23)/b11-7+ |
| InChIKey | RSONMGCWIIVHRN-YRNVUSSQSA-N |
| XLogP | 4.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|