C19H17N3O4 — CID 110411159
N,N-dimethyl-4-[(E)-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]prop-1-enyl]benzamide (PubChem CID 110411159) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]prop-1-enyl]benzamide.
| Compound Name | N,N-dimethyl-4-[(E)-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 110411159 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N,N-dimethyl-4-[(E)-3-oxo-3-[(2-oxo-3H-1,3-benzoxazol-6-yl)amino]prop-1-enyl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(/C=C/C(=O)Nc2ccc3[nH]c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-22(2)18(24)13-6-3-12(4-7-13)5-10-17(23)20-14-8-9-15-16(11-14)26-19(25)21-15/h3-11H,1-2H3,(H,20,23)(H,21,25)/b10-5+ |
| InChIKey | TYXVTGCNAVGJEZ-BJMVGYQFSA-N |
| XLogP | 2.47 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|