C22H26N4O3 — CID 110615421
4-[(E)-3-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N,N-dimethylbenzamide (PubChem CID 110615421) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[(E)-3-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-3-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 110615421 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[(E)-3-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(/C=C/C(=O)NCC(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-25(2)19-12-10-18(11-13-19)24-21(28)15-23-20(27)14-7-16-5-8-17(9-6-16)22(29)26(3)4/h5-14H,15H2,1-4H3,(H,23,27)(H,24,28)/b14-7+ |
| InChIKey | BXAWRVWNABWTQX-VGOFMYFVSA-N |
| XLogP | 2.22 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|