C15H29N — CID 134365055
(3E,5Z)-N-butyl-N-ethyl-2-methylocta-3,5-dien-4-amine (PubChem CID 134365055) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (3E,5Z)-N-butyl-N-ethyl-2-methylocta-3,5-dien-4-amine.
| Compound Name | (3E,5Z)-N-butyl-N-ethyl-2-methylocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 134365055 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (3E,5Z)-N-butyl-N-ethyl-2-methylocta-3,5-dien-4-amine |
| SMILES | CC/C=C\C(=C/C(C)C)N(CC)CCCC |
| InChI | InChI=1S/C15H29N/c1-6-9-11-15(13-14(4)5)16(8-3)12-10-7-2/h9,11,13-14H,6-8,10,12H2,1-5H3/b11-9-,15-13+ |
| InChIKey | BWDYLMXUHWYFMQ-NPEMSZEQSA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|