C15H32N2O — CID 87897947
1-octyl-1,3-dipropylurea (PubChem CID 87897947) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-octyl-1,3-dipropylurea.
| Compound Name | 1-octyl-1,3-dipropylurea |
|---|---|
| PubChem CID | 87897947 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 1-octyl-1,3-dipropylurea |
| SMILES | CCCCCCCCN(CCC)C(=O)NCCC |
| InChI | InChI=1S/C15H32N2O/c1-4-7-8-9-10-11-14-17(13-6-3)15(18)16-12-5-2/h4-14H2,1-3H3,(H,16,18) |
| InChIKey | KPZYWFVSUBXMGQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|