C26H56N2O — CID 163789497
methane;1,1,3-trioctylurea (PubChem CID 163789497) has the molecular formula C26H56N2O and a molecular weight of 412.75 g/mol. Its IUPAC name is methane;1,1,3-trioctylurea.
| Compound Name | methane;1,1,3-trioctylurea |
|---|---|
| PubChem CID | 163789497 |
| Molecular Formula | C26H56N2O |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.44 |
| IUPAC Name | methane;1,1,3-trioctylurea |
| SMILES | C.CCCCCCCCNC(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C25H52N2O.CH4/c1-4-7-10-13-16-19-22-26-25(28)27(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-24H2,1-3H3,(H,26,28);1H4 |
| InChIKey | MVKWYVNYWLVLMS-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|