C22H45N3O2 — CID 89190547
1,3-diheptyl-1-(hexylcarbamoyl)urea (PubChem CID 89190547) has the molecular formula C22H45N3O2 and a molecular weight of 383.62 g/mol. Its IUPAC name is 1,3-diheptyl-1-(hexylcarbamoyl)urea.
| Compound Name | 1,3-diheptyl-1-(hexylcarbamoyl)urea |
|---|---|
| PubChem CID | 89190547 |
| Molecular Formula | C22H45N3O2 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.35 |
| IUPAC Name | 1,3-diheptyl-1-(hexylcarbamoyl)urea |
| SMILES | CCCCCCCNC(=O)N(CCCCCCC)C(=O)NCCCCCC |
| InChI | InChI=1S/C22H45N3O2/c1-4-7-10-13-16-19-24-22(27)25(20-17-14-11-8-5-2)21(26)23-18-15-12-9-6-3/h4-20H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | HXLHVWYQVHYKQT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|