C23H38N6O5 — CID 91004172
1,3-bis(6-isocyanatohexyl)-1-(1-isocyanatohexylcarbamoyl)urea (PubChem CID 91004172) has the molecular formula C23H38N6O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1,3-bis(6-isocyanatohexyl)-1-(1-isocyanatohexylcarbamoyl)urea.
| Compound Name | 1,3-bis(6-isocyanatohexyl)-1-(1-isocyanatohexylcarbamoyl)urea |
|---|---|
| PubChem CID | 91004172 |
| Molecular Formula | C23H38N6O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1,3-bis(6-isocyanatohexyl)-1-(1-isocyanatohexylcarbamoyl)urea |
| SMILES | CCCCCC(N=C=O)NC(=O)N(CCCCCCN=C=O)C(=O)NCCCCCCN=C=O |
| InChI | InChI=1S/C23H38N6O5/c1-2-3-8-13-21(27-20-32)28-23(34)29(17-12-7-6-10-15-25-19-31)22(33)26-16-11-5-4-9-14-24-18-30/h21H,2-17H2,1H3,(H,26,33)(H,28,34) |
| InChIKey | XJDZVOJPEGGMNN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|