C31H46N12O10 — CID 158686755
1,3-bis(6-isocyanatohexyl)-1-(6-isocyanatohexylcarbamoyl)urea;1,3-bis(isocyanatomethyl)-1-(isocyanatomethylcarbamoyl)urea (PubChem CID 158686755) has the molecular formula C31H46N12O10 and a molecular weight of 746.78 g/mol. Its IUPAC name is 1,3-bis(6-isocyanatohexyl)-1-(6-isocyanatohexylcarbamoyl)urea;1,3-bis(isocyanatomethyl)-1-(isocyanatomethylcarbamoyl)urea.
| Compound Name | 1,3-bis(6-isocyanatohexyl)-1-(6-isocyanatohexylcarbamoyl)urea;1,3-bis(isocyanatomethyl)-1-(isocyanatomethylcarbamoyl)urea |
|---|---|
| PubChem CID | 158686755 |
| Molecular Formula | C31H46N12O10 |
| Molecular Weight | 746.78 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | 1,3-bis(6-isocyanatohexyl)-1-(6-isocyanatohexylcarbamoyl)urea;1,3-bis(isocyanatomethyl)-1-(isocyanatomethylcarbamoyl)urea |
| SMILES | O=C=NCCCCCCNC(=O)N(CCCCCCN=C=O)C(=O)NCCCCCCN=C=O.O=C=NCNC(=O)N(CN=C=O)C(=O)NCN=C=O |
| InChI | InChI=1S/C23H38N6O5.C8H8N6O5/c30-19-24-13-7-1-3-10-16-27-22(33)29(18-12-6-5-9-15-26-21-32)23(34)28-17-11-4-2-8-14-25-20-31;15-4-9-1-12-7(18)14(3-11-6-17)8(19)13-2-10-5-16/h1-18H2,(H,27,33)(H,28,34);1-3H2,(H,12,18)(H,13,19) |
| InChIKey | IFVJTTNHQIFTCK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 299.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|