C50H98N8O8 — CID 20789752
4-[6-[bis(heptylcarbamoyl)amino]hexylcarbamoyloxy]butyl N-[6-[bis(heptylcarbamoyl)amino]hexyl]carbamate (PubChem CID 20789752) has the molecular formula C50H98N8O8 and a molecular weight of 939.38 g/mol. Its IUPAC name is 4-[6-[bis(heptylcarbamoyl)amino]hexylcarbamoyloxy]butyl N-[6-[bis(heptylcarbamoyl)amino]hexyl]carbamate.
| Compound Name | 4-[6-[bis(heptylcarbamoyl)amino]hexylcarbamoyloxy]butyl N-[6-[bis(heptylcarbamoyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 20789752 |
| Molecular Formula | C50H98N8O8 |
| Molecular Weight | 939.38 g/mol |
| Exact Mass | 938.75 |
| IUPAC Name | 4-[6-[bis(heptylcarbamoyl)amino]hexylcarbamoyloxy]butyl N-[6-[bis(heptylcarbamoyl)amino]hexyl]carbamate |
| SMILES | CCCCCCCNC(=O)N(CCCCCCNC(=O)OCCCCOC(=O)NCCCCCCN(C(=O)NCCCCCCC)C(=O)NCCCCCCC)C(=O)NCCCCCCC |
| InChI | InChI=1S/C50H98N8O8/c1-5-9-13-17-25-35-51-45(59)57(46(60)52-36-26-18-14-10-6-2)41-31-23-21-29-39-55-49(63)65-43-33-34-44-66-50(64)56-40-30-22-24-32-42-58(47(61)53-37-27-19-15-11-7-3)48(62)54-38-28-20-16-12-8-4/h5-44H2,1-4H3,(H,51,59)(H,52,60)(H,53,61)(H,54,62)(H,55,63)(H,56,64) |
| InChIKey | MJNFQORIGVLGGD-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 199.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.38 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|