About decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate
decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate (PubChem CID 173281202) has the molecular formula C33H66N2O6
and a molecular weight of 586.90 g/mol. Its IUPAC name is decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate.
Molecular Properties
| Compound Name | decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate |
| PubChem CID | 173281202 |
| Molecular Formula | C33H66N2O6 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.49 |
| IUPAC Name | decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate |
| SMILES | CCCCCCCCCCOC(=O)N(CCCCC)C(=O)O.CCCCCCCCCCOC(=O)NCCCCC |
| InChI | InChI=1S/C17H33NO4.C16H33NO2/c1-3-5-7-8-9-10-11-13-15-22-17(21)18(16(19)20)14-12-6-4-2;1-3-5-7-8-9-10-11-13-15-19-16(18)17-14-12-6-4-2/h3-15H2,1-2H3,(H,19,20);3-15H2,1-2H3,(H,17,18) |
| InChIKey | UKXYXNAPIPAQSJ-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate?
The IUPAC name of decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate (CID 173281202) is decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate.
What is the SMILES notation for decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate?
The canonical SMILES for decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate is CCCCCCCCCCOC(=O)N(CCCCC)C(=O)O.CCCCCCCCCCOC(=O)NCCCCC.
What is the InChIKey of decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate?
The InChIKey is UKXYXNAPIPAQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO4.C16H33NO2/c1-3-5-7-8-9-10-11-13-15-22-17(21)18(16(19)20)14-12-6-4-2;1-3-5-7-8-9-10-11-13-15-19-16(18)17-14-12-6-4-2/h3-15H2,1-2H3,(H,19,20);3-15H2,1-2H3,(H,17,18).
What are the key properties of decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate?
decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate has a molecular weight of 586.90 g/mol, XLogP of 10.48, 26 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for decoxycarbonyl(pentyl)carbamic acid;decyl N-pentylcarbamate is sourced from PubChem (CID 173281202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).