C19H40N2S — CID 19875506
1,1,3-trihexylthiourea (PubChem CID 19875506) has the molecular formula C19H40N2S and a molecular weight of 328.61 g/mol. Its IUPAC name is 1,1,3-trihexylthiourea.
| Compound Name | 1,1,3-trihexylthiourea |
|---|---|
| PubChem CID | 19875506 |
| Molecular Formula | C19H40N2S |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 1,1,3-trihexylthiourea |
| SMILES | CCCCCCNC(=S)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C19H40N2S/c1-4-7-10-13-16-20-19(22)21(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3,(H,20,22) |
| InChIKey | GYFPUUGZEAOPGL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|