C14H30N2S — CID 19653408
1,1-dihexyl-3-methylthiourea (PubChem CID 19653408) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is 1,1-dihexyl-3-methylthiourea.
| Compound Name | 1,1-dihexyl-3-methylthiourea |
|---|---|
| PubChem CID | 19653408 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1,1-dihexyl-3-methylthiourea |
| SMILES | CCCCCCN(CCCCCC)C(=S)NC |
| InChI | InChI=1S/C14H30N2S/c1-4-6-8-10-12-16(14(17)15-3)13-11-9-7-5-2/h4-13H2,1-3H3,(H,15,17) |
| InChIKey | XIPBMCSZGSSJBE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|